C25H29BF2N4O2 — CID 71665720
N-[2-[3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoylamino]ethyl]-3-phenylpropanamide (PubChem CID 71665720) has the molecular formula C25H29BF2N4O2 and a molecular weight of 466.34 g/mol. Its IUPAC name is N-[2-[3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoylamino]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoylamino]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 71665720 |
| Molecular Formula | C25H29BF2N4O2 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[2-[3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)propanoylamino]ethyl]-3-phenylpropanamide |
| SMILES | Cc1cc(C)n2c1C=C1C=CC(CCC(=O)NCCNC(=O)CCc3ccccc3)=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C25H29BF2N4O2/c1-18-16-19(2)31-23(18)17-22-10-9-21(32(22)26(31,27)28)11-13-25(34)30-15-14-29-24(33)12-8-20-6-4-3-5-7-20/h3-7,9-10,16-17H,8,11-15H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | ACTAAHZBMHAINS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|