C16H22O3 — CID 71665735
methyl (1R,2E,6E,10R,11S)-3-formyl-7,11-dimethylbicyclo[8.1.0]undeca-2,6-diene-11-carboxylate (PubChem CID 71665735) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (1R,2E,6E,10R,11S)-3-formyl-7,11-dimethylbicyclo[8.1.0]undeca-2,6-diene-11-carboxylate.
| Compound Name | methyl (1R,2E,6E,10R,11S)-3-formyl-7,11-dimethylbicyclo[8.1.0]undeca-2,6-diene-11-carboxylate |
|---|---|
| PubChem CID | 71665735 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (1R,2E,6E,10R,11S)-3-formyl-7,11-dimethylbicyclo[8.1.0]undeca-2,6-diene-11-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@@H]2/C=C(/C=O)CC/C=C(\C)CC[C@H]21 |
| InChI | InChI=1S/C16H22O3/c1-11-5-4-6-12(10-17)9-14-13(8-7-11)16(14,2)15(18)19-3/h5,9-10,13-14H,4,6-8H2,1-3H3/b11-5+,12-9+/t13-,14-,16+/m1/s1 |
| InChIKey | NRZFMXMBODNUGB-ZTFMBOIGSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|