C22H26N8O3 — CID 71666472
4-[4-[[3-[4-(2-methoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]cyclohexan-1-ol (PubChem CID 71666472) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 4-[4-[[3-[4-(2-methoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-[[3-[4-(2-methoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 71666472 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-[4-[[3-[4-(2-methoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]cyclohexan-1-ol |
| SMILES | COCCOc1ccc(-n2nnc3cnc(Nc4cnn(C5CCC(O)CC5)c4)nc32)cc1 |
| InChI | InChI=1S/C22H26N8O3/c1-32-10-11-33-19-8-4-17(5-9-19)30-21-20(27-28-30)13-23-22(26-21)25-15-12-24-29(14-15)16-2-6-18(31)7-3-16/h4-5,8-9,12-14,16,18,31H,2-3,6-7,10-11H2,1H3,(H,23,25,26) |
| InChIKey | PALYRVDJTLVNGN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|