About 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile
4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile (PubChem CID 71666608) has the molecular formula C18H17FN4O
and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile |
| PubChem CID | 71666608 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile |
| SMILES | CO[C@H](C)[C@H](N)c1nc2ccc(-c3ccc(C#N)cc3F)cc2[nH]1 |
| InChI | InChI=1S/C18H17FN4O/c1-10(24-2)17(21)18-22-15-6-4-12(8-16(15)23-18)13-5-3-11(9-20)7-14(13)19/h3-8,10,17H,21H2,1-2H3,(H,22,23)/t10-,17+/m1/s1 |
| InChIKey | BPXICYXGGPFBIH-QGHHPUGFSA-N |
| XLogP | 3.28 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile?
The IUPAC name of 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile (CID 71666608) is 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile.
What is the SMILES notation for 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile?
The canonical SMILES for 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile is CO[C@H](C)[C@H](N)c1nc2ccc(-c3ccc(C#N)cc3F)cc2[nH]1.
What is the InChIKey of 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile?
The InChIKey is BPXICYXGGPFBIH-QGHHPUGFSA-N. The full InChI is InChI=1S/C18H17FN4O/c1-10(24-2)17(21)18-22-15-6-4-12(8-16(15)23-18)13-5-3-11(9-20)7-14(13)19/h3-8,10,17H,21H2,1-2H3,(H,22,23)/t10-,17+/m1/s1.
What are the key properties of 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile?
4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile has a molecular weight of 324.36 g/mol, XLogP of 3.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1R,2R)-1-amino-2-methoxypropyl]-3H-benzimidazol-5-yl]-3-fluorobenzonitrile is sourced from PubChem (CID 71666608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).