C13H14Cl4N2O2S — CID 7166662
N'-benzyl-2,2,2-trichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]ethanimidamide (PubChem CID 7166662) has the molecular formula C13H14Cl4N2O2S and a molecular weight of 404.15 g/mol. Its IUPAC name is N'-benzyl-2,2,2-trichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]ethanimidamide.
| Compound Name | N'-benzyl-2,2,2-trichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 7166662 |
| Molecular Formula | C13H14Cl4N2O2S |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | N'-benzyl-2,2,2-trichloro-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]ethanimidamide |
| SMILES | O=S1(=O)C[C@H](N/C(=N/Cc2ccccc2)C(Cl)(Cl)Cl)[C@@H](Cl)C1 |
| InChI | InChI=1S/C13H14Cl4N2O2S/c14-10-7-22(20,21)8-11(10)19-12(13(15,16)17)18-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | BZYTUPUKUQEHOS-QWRGUYRKSA-N |
| XLogP | 2.95 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|