About 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol
2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 71666848) has the molecular formula C18H13ClO
and a molecular weight of 280.75 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 71666848 |
| Molecular Formula | C18H13ClO |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | OC1c2ccccc2C=CC1C#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClO/c19-16-6-3-4-13(12-16)8-9-15-11-10-14-5-1-2-7-17(14)18(15)20/h1-7,10-12,15,18,20H |
| InChIKey | USAGZWBWLGQEGE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol?
The IUPAC name of 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol (CID 71666848) is 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol is OC1c2ccccc2C=CC1C#Cc1cccc(Cl)c1.
What is the InChIKey of 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol?
The InChIKey is USAGZWBWLGQEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClO/c19-16-6-3-4-13(12-16)8-9-15-11-10-14-5-1-2-7-17(14)18(15)20/h1-7,10-12,15,18,20H.
What are the key properties of 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol?
2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol has a molecular weight of 280.75 g/mol, XLogP of 4.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-chlorophenyl)ethynyl]-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 71666848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).