C23H22N4O — CID 71666857
5-[4-[4-(1H-indol-3-yl)oxan-4-yl]phenyl]pyrimidin-2-amine (PubChem CID 71666857) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[4-[4-(1H-indol-3-yl)oxan-4-yl]phenyl]pyrimidin-2-amine.
| Compound Name | 5-[4-[4-(1H-indol-3-yl)oxan-4-yl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71666857 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-[4-[4-(1H-indol-3-yl)oxan-4-yl]phenyl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccc(C3(c4c[nH]c5ccccc45)CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C23H22N4O/c24-22-26-13-17(14-27-22)16-5-7-18(8-6-16)23(9-11-28-12-10-23)20-15-25-21-4-2-1-3-19(20)21/h1-8,13-15,25H,9-12H2,(H2,24,26,27) |
| InChIKey | KKOIMCMKSGWTHZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |