C25H29ClN2O2 — CID 71667179
2-(4-chlorophenyl)-4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-1-benzofuran-5-ol (PubChem CID 71667179) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-1-benzofuran-5-ol.
| Compound Name | 2-(4-chlorophenyl)-4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 71667179 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-1-benzofuran-5-ol |
| SMILES | Oc1ccc2oc(-c3ccc(Cl)cc3)cc2c1CN1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H29ClN2O2/c26-19-6-4-18(5-7-19)25-16-21-22(23(29)8-9-24(21)30-25)17-27-14-10-20(11-15-27)28-12-2-1-3-13-28/h4-9,16,20,29H,1-3,10-15,17H2 |
| InChIKey | HLRZSZQQDFDQKL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|