About 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine
3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 71667184) has the molecular formula C19H20N8O2
and a molecular weight of 392.42 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine |
| PubChem CID | 71667184 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | COc1ccc(-n2nnc3cnc(Nc4cnn(C5CCOCC5)c4)nc32)cc1 |
| InChI | InChI=1S/C19H20N8O2/c1-28-16-4-2-15(3-5-16)27-18-17(24-25-27)11-20-19(23-18)22-13-10-21-26(12-13)14-6-8-29-9-7-14/h2-5,10-12,14H,6-9H2,1H3,(H,20,22,23) |
| InChIKey | SNADXKVNPMPCNI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine?
The IUPAC name of 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine (CID 71667184) is 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine.
What is the SMILES notation for 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine?
The canonical SMILES for 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine is COc1ccc(-n2nnc3cnc(Nc4cnn(C5CCOCC5)c4)nc32)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine?
The InChIKey is SNADXKVNPMPCNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N8O2/c1-28-16-4-2-15(3-5-16)27-18-17(24-25-27)11-20-19(23-18)22-13-10-21-26(12-13)14-6-8-29-9-7-14/h2-5,10-12,14H,6-9H2,1H3,(H,20,22,23).
What are the key properties of 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine?
3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine has a molecular weight of 392.42 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-N-[1-(oxan-4-yl)pyrazol-4-yl]triazolo[4,5-d]pyrimidin-5-amine is sourced from PubChem (CID 71667184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).