C30H29ClN2O7S2 — CID 71667831
3-[5-[(2-chlorophenyl)methylcarbamoyl]-1',1'-dioxo-2-prop-2-enylspiro[2H-indole-3,4'-thiane]-1-yl]sulfonylbenzoic acid (PubChem CID 71667831) has the molecular formula C30H29ClN2O7S2 and a molecular weight of 629.16 g/mol. Its IUPAC name is 3-[5-[(2-chlorophenyl)methylcarbamoyl]-1',1'-dioxo-2-prop-2-enylspiro[2H-indole-3,4'-thiane]-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[5-[(2-chlorophenyl)methylcarbamoyl]-1',1'-dioxo-2-prop-2-enylspiro[2H-indole-3,4'-thiane]-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 71667831 |
| Molecular Formula | C30H29ClN2O7S2 |
| Molecular Weight | 629.16 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | 3-[5-[(2-chlorophenyl)methylcarbamoyl]-1',1'-dioxo-2-prop-2-enylspiro[2H-indole-3,4'-thiane]-1-yl]sulfonylbenzoic acid |
| SMILES | C=CCC1N(S(=O)(=O)c2cccc(C(=O)O)c2)c2ccc(C(=O)NCc3ccccc3Cl)cc2C12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C30H29ClN2O7S2/c1-2-6-27-30(13-15-41(37,38)16-14-30)24-18-20(28(34)32-19-22-7-3-4-10-25(22)31)11-12-26(24)33(27)42(39,40)23-9-5-8-21(17-23)29(35)36/h2-5,7-12,17-18,27H,1,6,13-16,19H2,(H,32,34)(H,35,36) |
| InChIKey | SOUPSBHBAXLZFE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.16 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|