C20H29O3- — CID 71668333
(5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoate (PubChem CID 71668333) has the molecular formula C20H29O3- and a molecular weight of 317.45 g/mol. Its IUPAC name is (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoate.
| Compound Name | (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 71668333 |
| Molecular Formula | C20H29O3- |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (5Z,8Z,10E,14Z)-12-oxoicosa-5,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\CC(=O)/C=C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17H,2-6,12,15-16,18H2,1H3,(H,22,23)/p-1/b9-7-,11-8-,13-10-,17-14+ |
| InChIKey | GURBRQGDZZKITB-VXBMJZGYSA-M |
| XLogP | 4.06 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|