C20H21NO7 — CID 71668708
methyl 2,5-dioxo-7-(2,3,4-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 71668708) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl 2,5-dioxo-7-(2,3,4-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl 2,5-dioxo-7-(2,3,4-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71668708 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 2,5-dioxo-7-(2,3,4-trimethoxyphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]c1=O)CC(c1ccc(OC)c(OC)c1OC)CC2=O |
| InChI | InChI=1S/C20H21NO7/c1-25-16-6-5-11(17(26-2)18(16)27-3)10-7-14-12(15(22)8-10)9-13(19(23)21-14)20(24)28-4/h5-6,9-10H,7-8H2,1-4H3,(H,21,23) |
| InChIKey | ZKZMBYIYMYCXJH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |