C9H12N6 — CID 71668927
7-piperazin-1-yl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 71668927) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 7-piperazin-1-yl-[1,2,4]triazolo[4,3-a]pyrimidine.
| Compound Name | 7-piperazin-1-yl-[1,2,4]triazolo[4,3-a]pyrimidine |
|---|---|
| PubChem CID | 71668927 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 7-piperazin-1-yl-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | c1cn2cnnc2nc1N1CCNCC1 |
| InChI | InChI=1S/C9H12N6/c1-4-15-7-11-13-9(15)12-8(1)14-5-2-10-3-6-14/h1,4,7,10H,2-3,5-6H2 |
| InChIKey | KLXWQLDZLDBDRA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |