C10H15N3O — CID 71669096
5-amino-N,N-dimethyl-2-(methylamino)benzamide (PubChem CID 71669096) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-amino-N,N-dimethyl-2-(methylamino)benzamide.
| Compound Name | 5-amino-N,N-dimethyl-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 71669096 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-amino-N,N-dimethyl-2-(methylamino)benzamide |
| SMILES | CNc1ccc(N)cc1C(=O)N(C)C |
| InChI | InChI=1S/C10H15N3O/c1-12-9-5-4-7(11)6-8(9)10(14)13(2)3/h4-6,12H,11H2,1-3H3 |
| InChIKey | WXCOFYJFUUFPIU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|