C22H21NO6 — CID 71669615
trimethyl (1R,2S,3S)-1,2,3,12b-tetrahydropyrrolo[1,2-f]phenanthridine-1,2,3-tricarboxylate (PubChem CID 71669615) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is trimethyl (1R,2S,3S)-1,2,3,12b-tetrahydropyrrolo[1,2-f]phenanthridine-1,2,3-tricarboxylate.
| Compound Name | trimethyl (1R,2S,3S)-1,2,3,12b-tetrahydropyrrolo[1,2-f]phenanthridine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 71669615 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | trimethyl (1R,2S,3S)-1,2,3,12b-tetrahydropyrrolo[1,2-f]phenanthridine-1,2,3-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)N2c3ccccc3-c3ccccc3C2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H21NO6/c1-27-20(24)16-17(21(25)28-2)19(22(26)29-3)23-15-11-7-6-9-13(15)12-8-4-5-10-14(12)18(16)23/h4-11,16-19H,1-3H3/t16-,17+,18?,19+/m1/s1 |
| InChIKey | MDCNUINGWVWWQV-HFIAIYGTSA-N |
| XLogP | 2.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|