C18H16O6S2 — CID 71669621
2-[2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)oxy]ethoxy]-1-benzothiophene 1,1-dioxide (PubChem CID 71669621) has the molecular formula C18H16O6S2 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)oxy]ethoxy]-1-benzothiophene 1,1-dioxide.
| Compound Name | 2-[2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)oxy]ethoxy]-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 71669621 |
| Molecular Formula | C18H16O6S2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)oxy]ethoxy]-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)CC(OCCOC2=Cc3ccccc3S2(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C18H16O6S2/c19-25(20)12-15(14-6-2-4-8-17(14)25)23-9-10-24-18-11-13-5-1-3-7-16(13)26(18,21)22/h1-8,11,15H,9-10,12H2 |
| InChIKey | PQDJGBUSDWPMJS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|