About (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride
(1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 71669707) has the molecular formula C5H10ClNS
and a molecular weight of 151.66 g/mol. Its IUPAC name is (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride.
Molecular Properties
| Compound Name | (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride |
| PubChem CID | 71669707 |
| Molecular Formula | C5H10ClNS |
| Molecular Weight | 151.66 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | C1S[C@H]2CN[C@@H]1C2.Cl |
| InChI | InChI=1S/C5H9NS.ClH/c1-4-3-7-5(1)2-6-4;/h4-6H,1-3H2;1H/t4-,5-;/m1./s1 |
| InChIKey | SJONZERYRAVRSB-TYSVMGFPSA-N |
| XLogP | 0.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.66 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride?
The IUPAC name of (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride (CID 71669707) is (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride.
What is the SMILES notation for (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride?
The canonical SMILES for (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride is C1S[C@H]2CN[C@@H]1C2.Cl.
What is the InChIKey of (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride?
The InChIKey is SJONZERYRAVRSB-TYSVMGFPSA-N. The full InChI is InChI=1S/C5H9NS.ClH/c1-4-3-7-5(1)2-6-4;/h4-6H,1-3H2;1H/t4-,5-;/m1./s1.
What are the key properties of (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride?
(1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride has a molecular weight of 151.66 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-2-thia-5-azabicyclo[2.2.1]heptane;hydrochloride is sourced from PubChem (CID 71669707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).