C6H5N5OS2 — CID 71670291
6-(2-amino-1,3-thiazol-4-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 71670291) has the molecular formula C6H5N5OS2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-(2-amino-1,3-thiazol-4-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-amino-1,3-thiazol-4-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 71670291 |
| Molecular Formula | C6H5N5OS2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 6-(2-amino-1,3-thiazol-4-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Nc1nc(-c2n[nH]c(=S)[nH]c2=O)cs1 |
| InChI | InChI=1S/C6H5N5OS2/c7-5-8-2(1-14-5)3-4(12)9-6(13)11-10-3/h1H,(H2,7,8)(H2,9,11,12,13) |
| InChIKey | UDPFBUOIYONUFW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|