C12H17BrS — CID 71670726
3-(1-bromoethyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene (PubChem CID 71670726) has the molecular formula C12H17BrS and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-(1-bromoethyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene.
| Compound Name | 3-(1-bromoethyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene |
|---|---|
| PubChem CID | 71670726 |
| Molecular Formula | C12H17BrS |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-(1-bromoethyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene |
| SMILES | CC(Br)c1csc2c1CCCCCC2 |
| InChI | InChI=1S/C12H17BrS/c1-9(13)11-8-14-12-7-5-3-2-4-6-10(11)12/h8-9H,2-7H2,1H3 |
| InChIKey | BAUHOTAKZMVDJK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|