C16H12F3N3O3S — CID 71671143
5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 71671143) has the molecular formula C16H12F3N3O3S and a molecular weight of 383.35 g/mol. Its IUPAC name is 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 71671143 |
| Molecular Formula | C16H12F3N3O3S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC1=CC(=C2C(=O)NC(=S)NC2=O)C=C(C(F)(F)F)N1Cc1ccco1 |
| InChI | InChI=1S/C16H12F3N3O3S/c1-8-5-9(12-13(23)20-15(26)21-14(12)24)6-11(16(17,18)19)22(8)7-10-3-2-4-25-10/h2-6H,7H2,1H3,(H2,20,21,23,24,26) |
| InChIKey | UMJWRKAELIDMNX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|