C20H21N5O2 — CID 71671202
2-(5-methyl-1H-1,2,4-triazol-3-yl)-8-pentylpyrido[4,3-g]isoquinoline-1,9-dione (PubChem CID 71671202) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(5-methyl-1H-1,2,4-triazol-3-yl)-8-pentylpyrido[4,3-g]isoquinoline-1,9-dione.
| Compound Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)-8-pentylpyrido[4,3-g]isoquinoline-1,9-dione |
|---|---|
| PubChem CID | 71671202 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)-8-pentylpyrido[4,3-g]isoquinoline-1,9-dione |
| SMILES | CCCCCn1ccc2cc3ccn(-c4n[nH]c(C)n4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C20H21N5O2/c1-3-4-5-8-24-9-6-14-11-15-7-10-25(20-21-13(2)22-23-20)19(27)17(15)12-16(14)18(24)26/h6-7,9-12H,3-5,8H2,1-2H3,(H,21,22,23) |
| InChIKey | MVUYIUXSUSISOR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|