C17H15N3O6S — CID 7167151
ethyl N-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carbonyl]carbamate (PubChem CID 7167151) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167151 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | ethyl N-[2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N3O6S/c1-2-26-17(23)19-15(22)13-9-10-27-16(13)18-14(21)8-5-11-3-6-12(7-4-11)20(24)25/h3-10H,2H2,1H3,(H,18,21)(H,19,22,23)/b8-5+ |
| InChIKey | ABZRYQZEDRDIGE-VMPITWQZSA-N |
| XLogP | 3.19 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|