C7H10F6N2O — CID 71672205
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-propan-2-ylurea (PubChem CID 71672205) has the molecular formula C7H10F6N2O and a molecular weight of 252.16 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-propan-2-ylurea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 71672205 |
| Molecular Formula | C7H10F6N2O |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6N2O/c1-3(2)14-5(16)15-4(6(8,9)10)7(11,12)13/h3-4H,1-2H3,(H2,14,15,16) |
| InChIKey | UPTHALCJJQMRLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |