C9H6F11NO2 — CID 71672266
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylpropanamide (PubChem CID 71672266) has the molecular formula C9H6F11NO2 and a molecular weight of 369.13 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 71672266 |
| Molecular Formula | C9H6F11NO2 |
| Molecular Weight | 369.13 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F11NO2/c1-2-3-21-4(22)5(10,7(13,14)15)23-9(19,20)6(11,12)8(16,17)18/h2H,1,3H2,(H,21,22) |
| InChIKey | JQQZWNQVWNPMOY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|