C12H18ClF6NO — CID 71672614
N,N-dibutyl-2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 71672614) has the molecular formula C12H18ClF6NO and a molecular weight of 341.72 g/mol. Its IUPAC name is N,N-dibutyl-2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N,N-dibutyl-2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672614 |
| Molecular Formula | C12H18ClF6NO |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N,N-dibutyl-2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCCCN(CCCC)C(=O)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18ClF6NO/c1-3-5-7-20(8-6-4-2)9(21)10(13,11(14,15)16)12(17,18)19/h3-8H2,1-2H3 |
| InChIKey | SUWDAHOOTUHISM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|