C10H10F11NO2 — CID 71672900
N,N-diethyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 71672900) has the molecular formula C10H10F11NO2 and a molecular weight of 385.17 g/mol. Its IUPAC name is N,N-diethyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | N,N-diethyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 71672900 |
| Molecular Formula | C10H10F11NO2 |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N,N-diethyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | CCN(CC)C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F11NO2/c1-3-22(4-2)5(23)6(11,8(14,15)16)24-10(20,21)7(12,13)9(17,18)19/h3-4H2,1-2H3 |
| InChIKey | JKPLZDRDWOXTIH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|