C8H2F12N4OS — CID 71672993
1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 71672993) has the molecular formula C8H2F12N4OS and a molecular weight of 430.17 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 71672993 |
| Molecular Formula | C8H2F12N4OS |
| Molecular Weight | 430.17 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12N4OS/c9-4(10,11)1-23-24-3(26-1)21-2(25)22-5(6(12,13)14,7(15,16)17)8(18,19)20/h(H2,21,22,24,25) |
| InChIKey | SEQLYWJQSSGPKB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |