C12H14F11NO2 — CID 71673114
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dipropylpropanamide (PubChem CID 71673114) has the molecular formula C12H14F11NO2 and a molecular weight of 413.23 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dipropylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 71673114 |
| Molecular Formula | C12H14F11NO2 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F11NO2/c1-3-5-24(6-4-2)7(25)8(13,10(16,17)18)26-12(22,23)9(14,15)11(19,20)21/h3-6H2,1-2H3 |
| InChIKey | RWGRYUPOMRGFBC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|