C33H31NO3 — CID 71674050
11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (PubChem CID 71674050) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
| Compound Name | 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
|---|---|
| PubChem CID | 71674050 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| SMILES | CCCOc1ccccc1N1C(=O)C23CC=CCC2(CC(=C(c2ccccc2)c2ccccc2)C3)C1=O |
| InChI | InChI=1S/C33H31NO3/c1-2-21-37-28-18-10-9-17-27(28)34-30(35)32-19-11-12-20-33(32,31(34)36)23-26(22-32)29(24-13-5-3-6-14-24)25-15-7-4-8-16-25/h3-18H,2,19-23H2,1H3 |
| InChIKey | CNIDGANKYGGSMD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|