About 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione
11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (PubChem CID 71674050) has the molecular formula C33H31NO3
and a molecular weight of 489.62 g/mol. Its IUPAC name is 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
Molecular Properties
| Compound Name | 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| PubChem CID | 71674050 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| SMILES | CCCOc1ccccc1N1C(=O)C23CC=CCC2(CC(=C(c2ccccc2)c2ccccc2)C3)C1=O |
| InChI | InChI=1S/C33H31NO3/c1-2-21-37-28-18-10-9-17-27(28)34-30(35)32-19-11-12-20-33(32,31(34)36)23-26(22-32)29(24-13-5-3-6-14-24)25-15-7-4-8-16-25/h3-18H,2,19-23H2,1H3 |
| InChIKey | CNIDGANKYGGSMD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The IUPAC name of 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (CID 71674050) is 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
What is the SMILES notation for 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The canonical SMILES for 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione is CCCOc1ccccc1N1C(=O)C23CC=CCC2(CC(=C(c2ccccc2)c2ccccc2)C3)C1=O.
What is the InChIKey of 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The InChIKey is CNIDGANKYGGSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H31NO3/c1-2-21-37-28-18-10-9-17-27(28)34-30(35)32-19-11-12-20-33(32,31(34)36)23-26(22-32)29(24-13-5-3-6-14-24)25-15-7-4-8-16-25/h3-18H,2,19-23H2,1H3.
What are the key properties of 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione has a molecular weight of 489.62 g/mol, XLogP of 6.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-benzhydrylidene-8-(2-propoxyphenyl)-8-azatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione is sourced from PubChem (CID 71674050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).