C27H17NO7 — CID 71674072
4-(1',3',4,6-tetraoxo-1-phenylspiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl)benzoic acid (PubChem CID 71674072) has the molecular formula C27H17NO7 and a molecular weight of 467.43 g/mol. Its IUPAC name is 4-(1',3',4,6-tetraoxo-1-phenylspiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl)benzoic acid.
| Compound Name | 4-(1',3',4,6-tetraoxo-1-phenylspiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl)benzoic acid |
|---|---|
| PubChem CID | 71674072 |
| Molecular Formula | C27H17NO7 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 4-(1',3',4,6-tetraoxo-1-phenylspiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)C3C(c4ccccc4)OC4(C(=O)c5ccccc5C4=O)C3C2=O)cc1 |
| InChI | InChI=1S/C27H17NO7/c29-22-17-8-4-5-9-18(17)23(30)27(22)20-19(21(35-27)14-6-2-1-3-7-14)24(31)28(25(20)32)16-12-10-15(11-13-16)26(33)34/h1-13,19-21H,(H,33,34) |
| InChIKey | ZEVXPGVOAUHRJI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|