C22H19N2O5- — CID 7167427
2-[4-[(Z)-[[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 7167427) has the molecular formula C22H19N2O5- and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-[4-[(Z)-[[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7167427 |
| Molecular Formula | C22H19N2O5- |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[4-[(Z)-[[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)N/N=C\c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O5/c1-15(29-20-11-8-17-4-2-3-5-18(17)12-20)22(27)24-23-13-16-6-9-19(10-7-16)28-14-21(25)26/h2-13,15H,14H2,1H3,(H,24,27)(H,25,26)/p-1/b23-13-/t15-/m1/s1 |
| InChIKey | MLZLBYHWUDXVEH-KSJDGYIASA-M |
| XLogP | 1.89 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|