C18H17N2OP — CID 71676342
4-N-diphenylphosphorylbenzene-1,4-diamine (PubChem CID 71676342) has the molecular formula C18H17N2OP and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-N-diphenylphosphorylbenzene-1,4-diamine.
| Compound Name | 4-N-diphenylphosphorylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 71676342 |
| Molecular Formula | C18H17N2OP |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-N-diphenylphosphorylbenzene-1,4-diamine |
| SMILES | Nc1ccc(NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N2OP/c19-15-11-13-16(14-12-15)20-22(21,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,19H2,(H,20,21) |
| InChIKey | SKNAFDGGHPGQHU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|