C22H28O6 — CID 71676380
[(2'S,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,2,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydrophenanthrene-7,1'-cyclopropane]-9-yl] acetate (PubChem CID 71676380) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(2'S,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,2,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydrophenanthrene-7,1'-cyclopropane]-9-yl] acetate.
| Compound Name | [(2'S,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,2,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydrophenanthrene-7,1'-cyclopropane]-9-yl] acetate |
|---|---|
| PubChem CID | 71676380 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(2'S,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,2,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydrophenanthrene-7,1'-cyclopropane]-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C2=C(C(=O)[C@H](O)[C@@]3(C[C@@H]3C)C2=O)[C@@]2(C)CCC(C)=C(C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C22H28O6/c1-9-6-7-21(5)14(11(9)3)16(24)18(28-12(4)23)13-15(21)17(25)20(27)22(19(13)26)8-10(22)2/h10,14,16,18,20,24,27H,6-8H2,1-5H3/t10-,14+,16-,18-,20-,21-,22+/m0/s1 |
| InChIKey | COUCVOMLOCIVHG-OXSKGJAVSA-N |
| XLogP | 1.88 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|