C23H32O6 — CID 71676383
(4aS,10aR)-8-hydroxy-5,6-dimethoxy-7-(1-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione (PubChem CID 71676383) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (4aS,10aR)-8-hydroxy-5,6-dimethoxy-7-(1-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione.
| Compound Name | (4aS,10aR)-8-hydroxy-5,6-dimethoxy-7-(1-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione |
|---|---|
| PubChem CID | 71676383 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (4aS,10aR)-8-hydroxy-5,6-dimethoxy-7-(1-methoxypropan-2-yl)-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione |
| SMILES | COCC(C)c1c(O)c2c(c(OC)c1OC)[C@@]1(C)CCCC(C)(C)[C@H]1C(=O)C2=O |
| InChI | InChI=1S/C23H32O6/c1-12(11-27-5)13-16(24)14-15(20(29-7)19(13)28-6)23(4)10-8-9-22(2,3)21(23)18(26)17(14)25/h12,21,24H,8-11H2,1-7H3/t12?,21-,23-/m1/s1 |
| InChIKey | FHXIDDGLYXABOP-SKNQQTLWSA-N |
| XLogP | 4.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|