C20H26O8 — CID 71676405
(2S,4aS,10aS)-7-(1,3-dihydroxypropan-2-yl)-2,5,6,8-tetrahydroxy-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione (PubChem CID 71676405) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is (2S,4aS,10aS)-7-(1,3-dihydroxypropan-2-yl)-2,5,6,8-tetrahydroxy-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione.
| Compound Name | (2S,4aS,10aS)-7-(1,3-dihydroxypropan-2-yl)-2,5,6,8-tetrahydroxy-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione |
|---|---|
| PubChem CID | 71676405 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2S,4aS,10aS)-7-(1,3-dihydroxypropan-2-yl)-2,5,6,8-tetrahydroxy-1,1,4a-trimethyl-2,3,4,10a-tetrahydrophenanthrene-9,10-dione |
| SMILES | CC1(C)[C@H]2C(=O)C(=O)c3c(O)c(C(CO)CO)c(O)c(O)c3[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C20H26O8/c1-19(2)9(23)4-5-20(3)12-11(15(26)17(28)18(19)20)13(24)10(8(6-21)7-22)14(25)16(12)27/h8-9,18,21-25,27H,4-7H2,1-3H3/t9-,18+,20+/m0/s1 |
| InChIKey | KTJXBZLBUASASE-JUVLLFOKSA-N |
| XLogP | 0.69 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|