About 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one
2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one (PubChem CID 71676426) has the molecular formula C25H18Br2O
and a molecular weight of 494.23 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one.
Molecular Properties
| Compound Name | 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one |
| PubChem CID | 71676426 |
| Molecular Formula | C25H18Br2O |
| Molecular Weight | 494.23 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one |
| SMILES | O=c1c(-c2ccccc2)cc2cc(CBr)c(CBr)cc2cc1-c1ccccc1 |
| InChI | InChI=1S/C25H18Br2O/c26-15-21-11-19-13-23(17-7-3-1-4-8-17)25(28)24(18-9-5-2-6-10-18)14-20(19)12-22(21)16-27/h1-14H,15-16H2 |
| InChIKey | KAKNFPBHAHXDFY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.23 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one?
The IUPAC name of 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one (CID 71676426) is 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one.
What is the SMILES notation for 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one?
The canonical SMILES for 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one is O=c1c(-c2ccccc2)cc2cc(CBr)c(CBr)cc2cc1-c1ccccc1.
What is the InChIKey of 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one?
The InChIKey is KAKNFPBHAHXDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18Br2O/c26-15-21-11-19-13-23(17-7-3-1-4-8-17)25(28)24(18-9-5-2-6-10-18)14-20(19)12-22(21)16-27/h1-14H,15-16H2.
What are the key properties of 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one?
2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one has a molecular weight of 494.23 g/mol, XLogP of 7.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(bromomethyl)-6,8-diphenylbenzo[7]annulen-7-one is sourced from PubChem (CID 71676426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).