About tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol
tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol (PubChem CID 71676443) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol.
Analyze tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol?
The IUPAC name of tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol (CID 71676443) is tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol.
What is the SMILES notation for tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol?
The canonical SMILES for tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol is OC12CC3CC1CC(C2)c1ccccc13.
What is the InChIKey of tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol?
The InChIKey is BFGGOZQIVLAOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O/c15-14-7-9-5-11(14)6-10(8-14)13-4-2-1-3-12(9)13/h1-4,9-11,15H,5-8H2.
What are the key properties of tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol?
tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol has a molecular weight of 200.28 g/mol, XLogP of 2.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trien-10-ol is sourced from PubChem (CID 71676443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).