C18H16BrClN2 — CID 71676847
6-bromo-2-[(4-chlorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 71676847) has the molecular formula C18H16BrClN2 and a molecular weight of 375.70 g/mol. Its IUPAC name is 6-bromo-2-[(4-chlorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-bromo-2-[(4-chlorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71676847 |
| Molecular Formula | C18H16BrClN2 |
| Molecular Weight | 375.70 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 6-bromo-2-[(4-chlorophenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1ccc(CN2CCc3c([nH]c4ccc(Br)cc34)C2)cc1 |
| InChI | InChI=1S/C18H16BrClN2/c19-13-3-6-17-16(9-13)15-7-8-22(11-18(15)21-17)10-12-1-4-14(20)5-2-12/h1-6,9,21H,7-8,10-11H2 |
| InChIKey | FXEPMSWIQBSUGK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|