About (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine
(E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine (PubChem CID 71677102) has the molecular formula C20H19N3O
and a molecular weight of 317.39 g/mol. Its IUPAC name is (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine.
Molecular Properties
| Compound Name | (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine |
| PubChem CID | 71677102 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine |
| SMILES | CCn1c2ccccc2c2cc(/C=N/c3onc(C)c3C)ccc21 |
| InChI | InChI=1S/C20H19N3O/c1-4-23-18-8-6-5-7-16(18)17-11-15(9-10-19(17)23)12-21-20-13(2)14(3)22-24-20/h5-12H,4H2,1-3H3/b21-12+ |
| InChIKey | WEPHTBXAUMLMBQ-CIAFOILYSA-N |
| XLogP | 5.17 |
| TPSA | 43.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine?
The IUPAC name of (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine (CID 71677102) is (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine.
What is the SMILES notation for (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine?
The canonical SMILES for (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine is CCn1c2ccccc2c2cc(/C=N/c3onc(C)c3C)ccc21.
What is the InChIKey of (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine?
The InChIKey is WEPHTBXAUMLMBQ-CIAFOILYSA-N. The full InChI is InChI=1S/C20H19N3O/c1-4-23-18-8-6-5-7-16(18)17-11-15(9-10-19(17)23)12-21-20-13(2)14(3)22-24-20/h5-12H,4H2,1-3H3/b21-12+.
What are the key properties of (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine?
(E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine has a molecular weight of 317.39 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3,4-dimethyl-1,2-oxazol-5-yl)-1-(9-ethylcarbazol-3-yl)methanimine is sourced from PubChem (CID 71677102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).