C27H19ClN6O4 — CID 71677195
(5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-nitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one (PubChem CID 71677195) has the molecular formula C27H19ClN6O4 and a molecular weight of 526.94 g/mol. Its IUPAC name is (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-nitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one.
| Compound Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-nitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 71677195 |
| Molecular Formula | C27H19ClN6O4 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-nitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C1\N=C(c2ccccc2)N(C(=O)c2ccc([N+](=O)[O-])cc2)NC1=O |
| InChI | InChI=1S/C27H19ClN6O4/c1-17-22(24(28)32(30-17)20-10-6-3-7-11-20)16-23-26(35)31-33(25(29-23)18-8-4-2-5-9-18)27(36)19-12-14-21(15-13-19)34(37)38/h2-16H,1H3,(H,31,35)/b23-16- |
| InChIKey | WQKPPIKYJVIAHS-KQWNVCNZSA-N |
| XLogP | 4.72 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|