About methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate
methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate (PubChem CID 71677759) has the molecular formula C16H12N2O2S
and a molecular weight of 296.35 g/mol. Its IUPAC name is methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate.
Molecular Properties
| Compound Name | methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate |
| PubChem CID | 71677759 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C16H12N2O2S/c1-20-16(19)13-4-2-11(3-5-13)14-10-21-15(18-14)12-6-8-17-9-7-12/h2-10H,1H3 |
| InChIKey | WUSWJLAQNARKGW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate?
The IUPAC name of methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate (CID 71677759) is methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate.
What is the SMILES notation for methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate?
The canonical SMILES for methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate is COC(=O)c1ccc(-c2csc(-c3ccncc3)n2)cc1.
What is the InChIKey of methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate?
The InChIKey is WUSWJLAQNARKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c1-20-16(19)13-4-2-11(3-5-13)14-10-21-15(18-14)12-6-8-17-9-7-12/h2-10H,1H3.
What are the key properties of methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate?
methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate has a molecular weight of 296.35 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-pyridin-4-yl-1,3-thiazol-4-yl)benzoate is sourced from PubChem (CID 71677759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).