About methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride
methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride (PubChem CID 71677806) has the molecular formula C5H12ClN3O2
and a molecular weight of 181.62 g/mol. Its IUPAC name is methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride |
| PubChem CID | 71677806 |
| Molecular Formula | C5H12ClN3O2 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(C)CC(=O)OC |
| InChI | InChI=1S/C5H11N3O2.ClH/c1-8(5(6)7)3-4(9)10-2;/h3H2,1-2H3,(H3,6,7);1H |
| InChIKey | GJZXUOJADNLGLP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride?
The IUPAC name of methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride (CID 71677806) is methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride.
What is the SMILES notation for methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride?
The canonical SMILES for methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride is Cl.[H]/N=C(\N)N(C)CC(=O)OC.
What is the InChIKey of methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride?
The InChIKey is GJZXUOJADNLGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2.ClH/c1-8(5(6)7)3-4(9)10-2;/h3H2,1-2H3,(H3,6,7);1H.
What are the key properties of methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride?
methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride has a molecular weight of 181.62 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[carbamimidoyl(methyl)amino]acetate;hydrochloride is sourced from PubChem (CID 71677806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).