C29H35ClN6O3 — CID 71677989
(1S,2S,3R,4S)-3-[[6-chloro-2-[2-[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 71677989) has the molecular formula C29H35ClN6O3 and a molecular weight of 551.09 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[[6-chloro-2-[2-[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4S)-3-[[6-chloro-2-[2-[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 71677989 |
| Molecular Formula | C29H35ClN6O3 |
| Molecular Weight | 551.09 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | (1S,2S,3R,4S)-3-[[6-chloro-2-[2-[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1ccc(-c2nc3ncc(Cl)c(N[C@H]4[C@@H](C(N)=O)[C@@H]5C=C[C@@H]4C5)c3[nH]2)c(C2CCN(C[C@H](C)O)CC2)c1 |
| InChI | InChI=1S/C29H35ClN6O3/c1-15(37)14-36-9-7-16(8-10-36)21-12-19(39-2)5-6-20(21)28-34-26-25(22(30)13-32-29(26)35-28)33-24-18-4-3-17(11-18)23(24)27(31)38/h3-6,12-13,15-18,23-24,37H,7-11,14H2,1-2H3,(H2,31,38)(H2,32,33,34,35)/t15-,17+,18+,23-,24+/m0/s1 |
| InChIKey | QXFCDZIFKISMBL-CLPQVTPGSA-N |
| XLogP | 3.93 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.09 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|