About N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide
N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide (PubChem CID 71678291) has the molecular formula C18H13BrFN5O
and a molecular weight of 414.24 g/mol. Its IUPAC name is N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide |
| PubChem CID | 71678291 |
| Molecular Formula | C18H13BrFN5O |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide |
| SMILES | O=C(Nc1c[nH]c2ncc(Br)cc12)c1cnn(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H13BrFN5O/c19-13-5-15-16(8-22-17(15)21-7-13)24-18(26)12-6-23-25(10-12)9-11-1-3-14(20)4-2-11/h1-8,10H,9H2,(H,21,22)(H,24,26) |
| InChIKey | JHZHSQCMNHPMQR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide?
The IUPAC name of N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide (CID 71678291) is N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide.
What is the SMILES notation for N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide?
The canonical SMILES for N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide is O=C(Nc1c[nH]c2ncc(Br)cc12)c1cnn(Cc2ccc(F)cc2)c1.
What is the InChIKey of N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide?
The InChIKey is JHZHSQCMNHPMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrFN5O/c19-13-5-15-16(8-22-17(15)21-7-13)24-18(26)12-6-23-25(10-12)9-11-1-3-14(20)4-2-11/h1-8,10H,9H2,(H,21,22)(H,24,26).
What are the key properties of N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide?
N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide has a molecular weight of 414.24 g/mol, XLogP of 3.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxamide is sourced from PubChem (CID 71678291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).