C21H20FN5O2 — CID 71678794
1-amino-7-(3-fluorophenyl)-N-[2-(2-oxoimidazolidin-1-yl)ethyl]isoquinoline-4-carboxamide (PubChem CID 71678794) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 1-amino-7-(3-fluorophenyl)-N-[2-(2-oxoimidazolidin-1-yl)ethyl]isoquinoline-4-carboxamide.
| Compound Name | 1-amino-7-(3-fluorophenyl)-N-[2-(2-oxoimidazolidin-1-yl)ethyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 71678794 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-amino-7-(3-fluorophenyl)-N-[2-(2-oxoimidazolidin-1-yl)ethyl]isoquinoline-4-carboxamide |
| SMILES | Nc1ncc(C(=O)NCCN2CCNC2=O)c2ccc(-c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C21H20FN5O2/c22-15-3-1-2-13(10-15)14-4-5-16-17(11-14)19(23)26-12-18(16)20(28)24-6-8-27-9-7-25-21(27)29/h1-5,10-12H,6-9H2,(H2,23,26)(H,24,28)(H,25,29) |
| InChIKey | XITGHWBDVILHGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |