C32H23Cl3F4N2O — CID 71679324
(5S)-3-[4-(1-benzhydryl-3-fluoroazetidin-3-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 71679324) has the molecular formula C32H23Cl3F4N2O and a molecular weight of 633.90 g/mol. Its IUPAC name is (5S)-3-[4-(1-benzhydryl-3-fluoroazetidin-3-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | (5S)-3-[4-(1-benzhydryl-3-fluoroazetidin-3-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 71679324 |
| Molecular Formula | C32H23Cl3F4N2O |
| Molecular Weight | 633.90 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | (5S)-3-[4-(1-benzhydryl-3-fluoroazetidin-3-yl)phenyl]-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | FC1(c2ccc(C3=NO[C@@](c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C32H23Cl3F4N2O/c33-25-15-24(16-26(34)28(25)35)31(32(37,38)39)17-27(40-42-31)20-11-13-23(14-12-20)30(36)18-41(19-30)29(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-16,29H,17-19H2/t31-/m0/s1 |
| InChIKey | QINCLOKAVIHKJZ-HKBQPEDESA-N |
| XLogP | 9.50 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.90 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|