C17H24F3N3O4S — CID 71679326
1-(1-butylsulfonylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 71679326) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is 1-(1-butylsulfonylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-butylsulfonylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71679326 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-(1-butylsulfonylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCCCS(=O)(=O)N1CCC(NC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F3N3O4S/c1-2-3-12-28(25,26)23-10-8-14(9-11-23)22-16(24)21-13-4-6-15(7-5-13)27-17(18,19)20/h4-7,14H,2-3,8-12H2,1H3,(H2,21,22,24) |
| InChIKey | PKBQCKUAWUJAPW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |