C22H18F6O8 — CID 71680527
bis(2,2,2-trifluoroethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboperoxoate (PubChem CID 71680527) has the molecular formula C22H18F6O8 and a molecular weight of 524.37 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboperoxoate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboperoxoate |
|---|---|
| PubChem CID | 71680527 |
| Molecular Formula | C22H18F6O8 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboperoxoate |
| SMILES | O=C(OOCC(F)(F)F)C1C(c2ccc(O)cc2)C(C(=O)OOCC(F)(F)F)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C22H18F6O8/c23-21(24,25)9-33-35-19(31)17-15(11-1-5-13(29)6-2-11)18(20(32)36-34-10-22(26,27)28)16(17)12-3-7-14(30)8-4-12/h1-8,15-18,29-30H,9-10H2 |
| InChIKey | UPRJPMHCJUMVHI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|