C34H52O7 — CID 71680581
(4aS,6aS,6bR,10S,12aR,14bS)-10-[(3S)-3-carboxy-3-hydroxypropanoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 71680581) has the molecular formula C34H52O7 and a molecular weight of 572.78 g/mol. Its IUPAC name is (4aS,6aS,6bR,10S,12aR,14bS)-10-[(3S)-3-carboxy-3-hydroxypropanoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (4aS,6aS,6bR,10S,12aR,14bS)-10-[(3S)-3-carboxy-3-hydroxypropanoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 71680581 |
| Molecular Formula | C34H52O7 |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | (4aS,6aS,6bR,10S,12aR,14bS)-10-[(3S)-3-carboxy-3-hydroxypropanoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)CC[C@H](OC(=O)C[C@H](O)C(=O)O)C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C34H52O7/c1-29(2)14-16-34(28(39)40)17-15-32(6)20(21(34)19-29)8-9-24-31(5)12-11-25(41-26(36)18-22(35)27(37)38)30(3,4)23(31)10-13-33(24,32)7/h8,21-25,35H,9-19H2,1-7H3,(H,37,38)(H,39,40)/t21-,22-,23?,24?,25-,31-,32+,33+,34-/m0/s1 |
| InChIKey | CUIIVXWVQVPPSY-FELVLCDFSA-N |
| XLogP | 6.62 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|