C43H50N10 — CID 71680586
1-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propyl]-1-[4-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propylamino]butyl]-2-naphthalen-1-ylguanidine (PubChem CID 71680586) has the molecular formula C43H50N10 and a molecular weight of 706.94 g/mol. Its IUPAC name is 1-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propyl]-1-[4-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propylamino]butyl]-2-naphthalen-1-ylguanidine.
| Compound Name | 1-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propyl]-1-[4-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propylamino]butyl]-2-naphthalen-1-ylguanidine |
|---|---|
| PubChem CID | 71680586 |
| Molecular Formula | C43H50N10 |
| Molecular Weight | 706.94 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | 1-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propyl]-1-[4-[3-[[amino-(naphthalen-1-ylamino)methylidene]amino]propylamino]butyl]-2-naphthalen-1-ylguanidine |
| SMILES | N/C(=N\CCCNCCCCN(CCC/N=C(\N)Nc1cccc2ccccc12)/C(N)=N/c1cccc2ccccc12)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C43H50N10/c44-41(50-38-23-9-17-32-14-1-4-20-35(32)38)48-28-12-27-47-26-7-8-30-53(43(46)52-40-25-11-19-34-16-3-6-22-37(34)40)31-13-29-49-42(45)51-39-24-10-18-33-15-2-5-21-36(33)39/h1-6,9-11,14-25,47H,7-8,12-13,26-31H2,(H2,46,52)(H3,44,48,50)(H3,45,49,51) |
| InChIKey | WXEORFAZCKQUIT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.94 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|